C20H29FN2O6S — CID 134829523
2-[(3R,6aR,8S,10aR)-1-(2-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide (PubChem CID 134829523) has the molecular formula C20H29FN2O6S and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[(3R,6aR,8S,10aR)-1-(2-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide.
| Compound Name | 2-[(3R,6aR,8S,10aR)-1-(2-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 134829523 |
| Molecular Formula | C20H29FN2O6S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-[(3R,6aR,8S,10aR)-1-(2-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)C[C@@H]1CC[C@@H]2[C@H](COC[C@H](O)CN2S(=O)(=O)c2ccccc2F)O1 |
| InChI | InChI=1S/C20H29FN2O6S/c1-2-9-22-20(25)10-15-7-8-17-18(29-15)13-28-12-14(24)11-23(17)30(26,27)19-6-4-3-5-16(19)21/h3-6,14-15,17-18,24H,2,7-13H2,1H3,(H,22,25)/t14-,15+,17-,18+/m1/s1 |
| InChIKey | ILEDVWGNSINMBI-ATLSCFEFSA-N |
| XLogP | 1.04 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |