C24H36FN3O7S — CID 54659426
2-[(3R,6aR,8S,10aR)-1-(3-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 54659426) has the molecular formula C24H36FN3O7S and a molecular weight of 529.63 g/mol. Its IUPAC name is 2-[(3R,6aR,8S,10aR)-1-(3-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[(3R,6aR,8S,10aR)-1-(3-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 54659426 |
| Molecular Formula | C24H36FN3O7S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-[(3R,6aR,8S,10aR)-1-(3-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(C[C@@H]1CC[C@@H]2[C@H](COC[C@H](O)CN2S(=O)(=O)c2cccc(F)c2)O1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C24H36FN3O7S/c25-18-3-1-4-21(13-18)36(31,32)28-15-19(29)16-34-17-23-22(28)6-5-20(35-23)14-24(30)26-7-2-8-27-9-11-33-12-10-27/h1,3-4,13,19-20,22-23,29H,2,5-12,14-17H2,(H,26,30)/t19-,20+,22-,23+/m1/s1 |
| InChIKey | JSTLBPNQIPARCE-SKWRMQMOSA-N |
| XLogP | 0.35 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|