C25H37FN4O6 — CID 54658711
(3S,6aR,8S,10aR)-N-(4-fluorophenyl)-3-hydroxy-8-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide (PubChem CID 54658711) has the molecular formula C25H37FN4O6 and a molecular weight of 508.59 g/mol. Its IUPAC name is (3S,6aR,8S,10aR)-N-(4-fluorophenyl)-3-hydroxy-8-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide.
| Compound Name | (3S,6aR,8S,10aR)-N-(4-fluorophenyl)-3-hydroxy-8-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
|---|---|
| PubChem CID | 54658711 |
| Molecular Formula | C25H37FN4O6 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (3S,6aR,8S,10aR)-N-(4-fluorophenyl)-3-hydroxy-8-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
| SMILES | O=C(C[C@@H]1CC[C@@H]2[C@H](COC[C@@H](O)CN2C(=O)Nc2ccc(F)cc2)O1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C25H37FN4O6/c26-18-2-4-19(5-3-18)28-25(33)30-15-20(31)16-35-17-23-22(30)7-6-21(36-23)14-24(32)27-8-1-9-29-10-12-34-13-11-29/h2-5,20-23,31H,1,6-17H2,(H,27,32)(H,28,33)/t20-,21-,22+,23-/m0/s1 |
| InChIKey | ZJVBEXBZNPERQO-GPJHCHHRSA-N |
| XLogP | 1.20 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|