C26H41N3O5 — CID 54658601
2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-phenylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 54658601) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-phenylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-phenylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 54658601 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-phenylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(C[C@H]1CC[C@@H]2[C@H](COC[C@H](O)CN2CCc2ccccc2)O1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C26H41N3O5/c30-22-18-29(12-9-21-5-2-1-3-6-21)24-8-7-23(34-25(24)20-33-19-22)17-26(31)27-10-4-11-28-13-15-32-16-14-28/h1-3,5-6,22-25,30H,4,7-20H2,(H,27,31)/t22-,23-,24-,25+/m1/s1 |
| InChIKey | BOUUMTCEQSQTHX-VPBXCIAMSA-N |
| XLogP | 1.07 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|