C18H25NO8S — CID 54659679
2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid (PubChem CID 54659679) has the molecular formula C18H25NO8S and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid.
| Compound Name | 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid |
|---|---|
| PubChem CID | 54659679 |
| Molecular Formula | C18H25NO8S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(2-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid |
| SMILES | COc1ccccc1S(=O)(=O)N1C[C@@H](O)COC[C@@H]2O[C@@H](CC(=O)O)CC[C@H]21 |
| InChI | InChI=1S/C18H25NO8S/c1-25-15-4-2-3-5-17(15)28(23,24)19-9-12(20)10-26-11-16-14(19)7-6-13(27-16)8-18(21)22/h2-5,12-14,16,20H,6-11H2,1H3,(H,21,22)/t12-,13-,14-,16+/m1/s1 |
| InChIKey | ADTQWVARRJXFKB-KQTLUZQSSA-N |
| XLogP | 0.47 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |