C23H34N2O7S — CID 54659135
2-[(3S,6aR,8S,10aR)-3-hydroxy-1-(3-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-piperidin-1-ylethanone (PubChem CID 54659135) has the molecular formula C23H34N2O7S and a molecular weight of 482.60 g/mol. Its IUPAC name is 2-[(3S,6aR,8S,10aR)-3-hydroxy-1-(3-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[(3S,6aR,8S,10aR)-3-hydroxy-1-(3-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 54659135 |
| Molecular Formula | C23H34N2O7S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-[(3S,6aR,8S,10aR)-3-hydroxy-1-(3-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-piperidin-1-ylethanone |
| SMILES | COc1cccc(S(=O)(=O)N2C[C@H](O)COC[C@@H]3O[C@H](CC(=O)N4CCCCC4)CC[C@H]32)c1 |
| InChI | InChI=1S/C23H34N2O7S/c1-30-18-6-5-7-20(12-18)33(28,29)25-14-17(26)15-31-16-22-21(25)9-8-19(32-22)13-23(27)24-10-3-2-4-11-24/h5-7,12,17,19,21-22,26H,2-4,8-11,13-16H2,1H3/t17-,19-,21+,22-/m0/s1 |
| InChIKey | BXXYTZRTADQXJZ-BZNRXQDOSA-N |
| XLogP | 1.40 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |