C25H38N2O6S — CID 54659579
2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(4-methylphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 54659579) has the molecular formula C25H38N2O6S and a molecular weight of 494.65 g/mol. Its IUPAC name is 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(4-methylphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(4-methylphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 54659579 |
| Molecular Formula | C25H38N2O6S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-[(3R,6aR,8R,10aR)-3-hydroxy-1-(4-methylphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](O)COC[C@@H]3O[C@@H](CC(=O)NCC4CCCCC4)CC[C@H]32)cc1 |
| InChI | InChI=1S/C25H38N2O6S/c1-18-7-10-22(11-8-18)34(30,31)27-15-20(28)16-32-17-24-23(27)12-9-21(33-24)13-25(29)26-14-19-5-3-2-4-6-19/h7-8,10-11,19-21,23-24,28H,2-6,9,12-17H2,1H3,(H,26,29)/t20-,21-,23-,24+/m1/s1 |
| InChIKey | SAYNGBVDCYLSDA-KOVSNXQUSA-N |
| XLogP | 2.38 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |