C17H22FNO7S — CID 54658872
2-[(3S,6aR,8R,10aR)-1-(4-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid (PubChem CID 54658872) has the molecular formula C17H22FNO7S and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-[(3S,6aR,8R,10aR)-1-(4-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid.
| Compound Name | 2-[(3S,6aR,8R,10aR)-1-(4-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid |
|---|---|
| PubChem CID | 54658872 |
| Molecular Formula | C17H22FNO7S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[(3S,6aR,8R,10aR)-1-(4-fluorophenyl)sulfonyl-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CC[C@@H]2[C@H](COC[C@@H](O)CN2S(=O)(=O)c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C17H22FNO7S/c18-11-1-4-14(5-2-11)27(23,24)19-8-12(20)9-25-10-16-15(19)6-3-13(26-16)7-17(21)22/h1-2,4-5,12-13,15-16,20H,3,6-10H2,(H,21,22)/t12-,13+,15+,16-/m0/s1 |
| InChIKey | JVBXXOACVQIGOP-XNISGKROSA-N |
| XLogP | 0.60 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |