C25H30N2O8S — CID 54659852
2-[(3R,6aR,8R,10aR)-1-(benzenesulfonyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-benzodioxol-5-ylmethyl)acetamide (PubChem CID 54659852) has the molecular formula C25H30N2O8S and a molecular weight of 518.59 g/mol. Its IUPAC name is 2-[(3R,6aR,8R,10aR)-1-(benzenesulfonyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-benzodioxol-5-ylmethyl)acetamide.
| Compound Name | 2-[(3R,6aR,8R,10aR)-1-(benzenesulfonyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 54659852 |
| Molecular Formula | C25H30N2O8S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 2-[(3R,6aR,8R,10aR)-1-(benzenesulfonyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
| SMILES | O=C(C[C@H]1CC[C@@H]2[C@H](COC[C@H](O)CN2S(=O)(=O)c2ccccc2)O1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H30N2O8S/c28-18-13-27(36(30,31)20-4-2-1-3-5-20)21-8-7-19(35-24(21)15-32-14-18)11-25(29)26-12-17-6-9-22-23(10-17)34-16-33-22/h1-6,9-10,18-19,21,24,28H,7-8,11-16H2,(H,26,29)/t18-,19-,21-,24+/m1/s1 |
| InChIKey | KBUZLYCMRCBKLA-ZRXZBVFWSA-N |
| XLogP | 1.42 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |