C25H30Cl2N2O7S — CID 54658175
2-[(3R,6aS,8R,10aS)-3-hydroxy-1-(4-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide (PubChem CID 54658175) has the molecular formula C25H30Cl2N2O7S and a molecular weight of 573.50 g/mol. Its IUPAC name is 2-[(3R,6aS,8R,10aS)-3-hydroxy-1-(4-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-[(3R,6aS,8R,10aS)-3-hydroxy-1-(4-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54658175 |
| Molecular Formula | C25H30Cl2N2O7S |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-[(3R,6aS,8R,10aS)-3-hydroxy-1-(4-methoxyphenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@@H](O)COC[C@H]3O[C@@H](CC(=O)NCc4ccc(Cl)c(Cl)c4)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C25H30Cl2N2O7S/c1-34-18-3-6-20(7-4-18)37(32,33)29-13-17(30)14-35-15-24-23(29)9-5-19(36-24)11-25(31)28-12-16-2-8-21(26)22(27)10-16/h2-4,6-8,10,17,19,23-24,30H,5,9,11-15H2,1H3,(H,28,31)/t17-,19-,23+,24-/m1/s1 |
| InChIKey | VCZWBEHYTKZVKP-DLQDVTGGSA-N |
| XLogP | 3.01 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |