C22H31Cl2N3O5 — CID 54658312
(3S,6aS,8S,10aS)-8-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]-3-hydroxy-N-propyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide (PubChem CID 54658312) has the molecular formula C22H31Cl2N3O5 and a molecular weight of 488.41 g/mol. Its IUPAC name is (3S,6aS,8S,10aS)-8-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]-3-hydroxy-N-propyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide.
| Compound Name | (3S,6aS,8S,10aS)-8-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]-3-hydroxy-N-propyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
|---|---|
| PubChem CID | 54658312 |
| Molecular Formula | C22H31Cl2N3O5 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (3S,6aS,8S,10aS)-8-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]-3-hydroxy-N-propyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
| SMILES | CCCNC(=O)N1C[C@H](O)COC[C@H]2O[C@H](CC(=O)NCc3ccc(Cl)c(Cl)c3)CC[C@@H]21 |
| InChI | InChI=1S/C22H31Cl2N3O5/c1-2-7-25-22(30)27-11-15(28)12-31-13-20-19(27)6-4-16(32-20)9-21(29)26-10-14-3-5-17(23)18(24)8-14/h3,5,8,15-16,19-20,28H,2,4,6-7,9-13H2,1H3,(H,25,30)(H,26,29)/t15-,16-,19-,20+/m0/s1 |
| InChIKey | UXFZTUSXOQXWDV-CPLUKWAASA-N |
| XLogP | 2.73 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |