C21H30Cl2N2O4 — CID 54659305
2-[(3S,6aR,8S,10aR)-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide (PubChem CID 54659305) has the molecular formula C21H30Cl2N2O4 and a molecular weight of 445.39 g/mol. Its IUPAC name is 2-[(3S,6aR,8S,10aR)-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide.
| Compound Name | 2-[(3S,6aR,8S,10aR)-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 54659305 |
| Molecular Formula | C21H30Cl2N2O4 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[(3S,6aR,8S,10aR)-1-[(3,4-dichlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)C[C@@H]1CC[C@@H]2[C@H](COC[C@@H](O)CN2Cc2ccc(Cl)c(Cl)c2)O1 |
| InChI | InChI=1S/C21H30Cl2N2O4/c1-2-7-24-21(27)9-16-4-6-19-20(29-16)13-28-12-15(26)11-25(19)10-14-3-5-17(22)18(23)8-14/h3,5,8,15-16,19-20,26H,2,4,6-7,9-13H2,1H3,(H,24,27)/t15-,16-,19+,20-/m0/s1 |
| InChIKey | IQIGJWNUIWVINT-FEHORTKBSA-N |
| XLogP | 3.02 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |