C24H30ClN3O4 — CID 54658837
2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(pyridin-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 54658837) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(pyridin-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(pyridin-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54658837 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(pyridin-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | O=C(C[C@@H]1CC[C@H]2[C@@H](COC[C@@H](O)CN2Cc2ccncc2)O1)NCc1ccccc1Cl |
| InChI | InChI=1S/C24H30ClN3O4/c25-21-4-2-1-3-18(21)12-27-24(30)11-20-5-6-22-23(32-20)16-31-15-19(29)14-28(22)13-17-7-9-26-10-8-17/h1-4,7-10,19-20,22-23,29H,5-6,11-16H2,(H,27,30)/t19-,20-,22-,23+/m0/s1 |
| InChIKey | ICFOLWILIFHXGX-BAMDZGJYSA-N |
| XLogP | 2.55 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |