C25H32FN3O4 — CID 54659791
2-[(3R,6aS,8S,10aS)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 54659791) has the molecular formula C25H32FN3O4 and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-[(3R,6aS,8S,10aS)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-[(3R,6aS,8S,10aS)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 54659791 |
| Molecular Formula | C25H32FN3O4 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 2-[(3R,6aS,8S,10aS)-1-[(3-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | O=C(C[C@@H]1CC[C@H]2[C@@H](COC[C@H](O)CN2Cc2cccc(F)c2)O1)NCCc1ccncc1 |
| InChI | InChI=1S/C25H32FN3O4/c26-20-3-1-2-19(12-20)14-29-15-21(30)16-32-17-24-23(29)5-4-22(33-24)13-25(31)28-11-8-18-6-9-27-10-7-18/h1-3,6-7,9-10,12,21-24,30H,4-5,8,11,13-17H2,(H,28,31)/t21-,22+,23+,24-/m1/s1 |
| InChIKey | XINMNOWMZQSCNC-NAVOZUGXSA-N |
| XLogP | 2.08 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |