C24H42N2O5 — CID 54660384
2-[(3S,6aR,8R,10aR)-3-hydroxy-1-(oxan-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 54660384) has the molecular formula C24H42N2O5 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-[(3S,6aR,8R,10aR)-3-hydroxy-1-(oxan-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(3S,6aR,8R,10aR)-3-hydroxy-1-(oxan-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 54660384 |
| Molecular Formula | C24H42N2O5 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 2-[(3S,6aR,8R,10aR)-3-hydroxy-1-(oxan-4-ylmethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | O=C(C[C@H]1CC[C@@H]2[C@H](COC[C@@H](O)CN2CC2CCOCC2)O1)NCC1CCCCC1 |
| InChI | InChI=1S/C24H42N2O5/c27-20-15-26(14-19-8-10-29-11-9-19)22-7-6-21(31-23(22)17-30-16-20)12-24(28)25-13-18-4-2-1-3-5-18/h18-23,27H,1-17H2,(H,25,28)/t20-,21+,22+,23-/m0/s1 |
| InChIKey | RGZNDINNLTYFNJ-AFXVXQJMSA-N |
| XLogP | 2.11 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |