C21H36N2O5 — CID 54658108
2-[(3R,6aS,8R,10aS)-3-hydroxy-1-propanoyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 54658108) has the molecular formula C21H36N2O5 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-[(3R,6aS,8R,10aS)-3-hydroxy-1-propanoyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(3R,6aS,8R,10aS)-3-hydroxy-1-propanoyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 54658108 |
| Molecular Formula | C21H36N2O5 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-[(3R,6aS,8R,10aS)-3-hydroxy-1-propanoyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | CCC(=O)N1C[C@@H](O)COC[C@H]2O[C@@H](CC(=O)NCC3CCCCC3)CC[C@@H]21 |
| InChI | InChI=1S/C21H36N2O5/c1-2-21(26)23-12-16(24)13-27-14-19-18(23)9-8-17(28-19)10-20(25)22-11-15-6-4-3-5-7-15/h15-19,24H,2-14H2,1H3,(H,22,25)/t16-,17-,18+,19-/m1/s1 |
| InChIKey | PBTPEISZAFDWRC-AKHDSKFASA-N |
| XLogP | 1.62 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |