C24H35N3O6 — CID 54658179
(3R,6aR,8R,10aR)-3-hydroxy-N-(4-methoxyphenyl)-8-(2-oxo-2-piperidin-1-ylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide (PubChem CID 54658179) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is (3R,6aR,8R,10aR)-3-hydroxy-N-(4-methoxyphenyl)-8-(2-oxo-2-piperidin-1-ylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide.
| Compound Name | (3R,6aR,8R,10aR)-3-hydroxy-N-(4-methoxyphenyl)-8-(2-oxo-2-piperidin-1-ylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
|---|---|
| PubChem CID | 54658179 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (3R,6aR,8R,10aR)-3-hydroxy-N-(4-methoxyphenyl)-8-(2-oxo-2-piperidin-1-ylethyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2C[C@@H](O)COC[C@@H]3O[C@@H](CC(=O)N4CCCCC4)CC[C@H]32)cc1 |
| InChI | InChI=1S/C24H35N3O6/c1-31-19-7-5-17(6-8-19)25-24(30)27-14-18(28)15-32-16-22-21(27)10-9-20(33-22)13-23(29)26-11-3-2-4-12-26/h5-8,18,20-22,28H,2-4,9-16H2,1H3,(H,25,30)/t18-,20-,21-,22+/m1/s1 |
| InChIKey | LFKOFJMZKCAIMA-NMIHRBCNSA-N |
| XLogP | 2.24 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |