C24H35N3O6 — CID 54659539
(3S,6aS,8S,10aS)-8-[2-(cyclopentylamino)-2-oxoethyl]-3-hydroxy-N-(3-methoxyphenyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide (PubChem CID 54659539) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is (3S,6aS,8S,10aS)-8-[2-(cyclopentylamino)-2-oxoethyl]-3-hydroxy-N-(3-methoxyphenyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide.
| Compound Name | (3S,6aS,8S,10aS)-8-[2-(cyclopentylamino)-2-oxoethyl]-3-hydroxy-N-(3-methoxyphenyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
|---|---|
| PubChem CID | 54659539 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (3S,6aS,8S,10aS)-8-[2-(cyclopentylamino)-2-oxoethyl]-3-hydroxy-N-(3-methoxyphenyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2C[C@H](O)COC[C@H]3O[C@H](CC(=O)NC4CCCC4)CC[C@@H]32)c1 |
| InChI | InChI=1S/C24H35N3O6/c1-31-19-8-4-7-17(11-19)26-24(30)27-13-18(28)14-32-15-22-21(27)10-9-20(33-22)12-23(29)25-16-5-2-3-6-16/h4,7-8,11,16,18,20-22,28H,2-3,5-6,9-10,12-15H2,1H3,(H,25,29)(H,26,30)/t18-,20-,21-,22+/m0/s1 |
| InChIKey | ZBTGSWDRRISCBN-JKLQHZFJSA-N |
| XLogP | 2.29 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |