C33H46N6O8S — CID 122385140
(2S)-2-[(3S,6S,9S)-6-benzyl-3-methyl-9-(2-methylpropyl)-10-(2-nitrophenyl)sulfonyl-2,5,8-trioxo-1,4,7,10-tetrazacyclotridec-1-yl]-4-methylpentanamide (PubChem CID 122385140) has the molecular formula C33H46N6O8S and a molecular weight of 686.83 g/mol. Its IUPAC name is (2S)-2-[(3S,6S,9S)-6-benzyl-3-methyl-9-(2-methylpropyl)-10-(2-nitrophenyl)sulfonyl-2,5,8-trioxo-1,4,7,10-tetrazacyclotridec-1-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[(3S,6S,9S)-6-benzyl-3-methyl-9-(2-methylpropyl)-10-(2-nitrophenyl)sulfonyl-2,5,8-trioxo-1,4,7,10-tetrazacyclotridec-1-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 122385140 |
| Molecular Formula | C33H46N6O8S |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | (2S)-2-[(3S,6S,9S)-6-benzyl-3-methyl-9-(2-methylpropyl)-10-(2-nitrophenyl)sulfonyl-2,5,8-trioxo-1,4,7,10-tetrazacyclotridec-1-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(N)=O)N1CCCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](CC(C)C)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)C1=O |
| InChI | InChI=1S/C33H46N6O8S/c1-21(2)18-27(30(34)40)37-16-11-17-38(48(46,47)29-15-10-9-14-26(29)39(44)45)28(19-22(3)4)32(42)36-25(20-24-12-7-6-8-13-24)31(41)35-23(5)33(37)43/h6-10,12-15,21-23,25,27-28H,11,16-20H2,1-5H3,(H2,34,40)(H,35,41)(H,36,42)/t23-,25-,27-,28-/m0/s1 |
| InChIKey | FNILIKSULZVPTC-QSLMFXOGSA-N |
| XLogP | 2.36 |
| TPSA | 202.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|