C32H31N3O5S — CID 15474437
(3S,6S)-3,6-dibenzyl-1-[(4-methylphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazin-2-one (PubChem CID 15474437) has the molecular formula C32H31N3O5S and a molecular weight of 569.68 g/mol. Its IUPAC name is (3S,6S)-3,6-dibenzyl-1-[(4-methylphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazin-2-one.
| Compound Name | (3S,6S)-3,6-dibenzyl-1-[(4-methylphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 15474437 |
| Molecular Formula | C32H31N3O5S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | (3S,6S)-3,6-dibenzyl-1-[(4-methylphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazin-2-one |
| SMILES | Cc1ccc(CN2C(=O)[C@H](Cc3ccccc3)N(S(=O)(=O)c3ccccc3[N+](=O)[O-])C[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31N3O5S/c1-24-16-18-27(19-17-24)22-33-28(20-25-10-4-2-5-11-25)23-34(30(32(33)36)21-26-12-6-3-7-13-26)41(39,40)31-15-9-8-14-29(31)35(37)38/h2-19,28,30H,20-23H2,1H3/t28-,30-/m0/s1 |
| InChIKey | FFJHVNTYNMKPKK-JDXGNMNLSA-N |
| XLogP | 5.16 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|