C21H24N2O4S — CID 10916383
(2S)-2-(2-methylpropyl)-1-(2-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine (PubChem CID 10916383) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (2S)-2-(2-methylpropyl)-1-(2-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine.
| Compound Name | (2S)-2-(2-methylpropyl)-1-(2-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 10916383 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2S)-2-(2-methylpropyl)-1-(2-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C[C@H]1CC=C(c2ccccc2)CN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O4S/c1-16(2)14-19-13-12-18(17-8-4-3-5-9-17)15-22(19)28(26,27)21-11-7-6-10-20(21)23(24)25/h3-12,16,19H,13-15H2,1-2H3/t19-/m1/s1 |
| InChIKey | QQJQVDBQZNYUHU-LJQANCHMSA-N |
| XLogP | 4.49 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|