C20H23Br2NO3 — CID 11113661
benzyl-[(1R,2R,3R,4S,5R)-3-bromo-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]azanium bromide (PubChem CID 11113661) has the molecular formula C20H23Br2NO3 and a molecular weight of 485.22 g/mol. Its IUPAC name is benzyl-[(1R,2R,3R,4S,5R)-3-bromo-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]azanium bromide.
| Compound Name | benzyl-[(1R,2R,3R,4S,5R)-3-bromo-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]azanium bromide |
|---|---|
| PubChem CID | 11113661 |
| Molecular Formula | C20H23Br2NO3 |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | benzyl-[(1R,2R,3R,4S,5R)-3-bromo-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]azanium bromide |
| SMILES | Br[C@@H]1[C@@H]([NH2+]Cc2ccccc2)[C@@H]2OC[C@@H](O2)[C@H]1OCc1ccccc1.[Br-] |
| InChI | InChI=1S/C20H22BrNO3.BrH/c21-17-18(22-11-14-7-3-1-4-8-14)20-24-13-16(25-20)19(17)23-12-15-9-5-2-6-10-15;/h1-10,16-20,22H,11-13H2;1H/t16-,17-,18-,19-,20-;/m1./s1 |
| InChIKey | CWKXQQKWOIGUFA-RTBQAPNASA-N |
| XLogP | -0.77 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|