C29H36O6SSi — CID 23583995
[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 23583995) has the molecular formula C29H36O6SSi and a molecular weight of 540.75 g/mol. Its IUPAC name is [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23583995 |
| Molecular Formula | C29H36O6SSi |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COC1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C29H36O6SSi/c1-22-16-18-23(19-17-22)36(30,31)33-21-27-26(20-28(32-5)34-27)35-37(29(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-19,26-28H,20-21H2,1-5H3/t26-,27+,28?/m0/s1 |
| InChIKey | RVUSVMPCVHMZDU-MDEZFMAYSA-N |
| XLogP | 4.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|