C26H32Br2N2O6Si — CID 11050598
5,5-dibromo-6-[[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methoxy]-1,3-diazinane-2,4-dione (PubChem CID 11050598) has the molecular formula C26H32Br2N2O6Si and a molecular weight of 656.44 g/mol. Its IUPAC name is 5,5-dibromo-6-[[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methoxy]-1,3-diazinane-2,4-dione.
| Compound Name | 5,5-dibromo-6-[[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methoxy]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 11050598 |
| Molecular Formula | C26H32Br2N2O6Si |
| Molecular Weight | 656.44 g/mol |
| Exact Mass | 654.04 |
| IUPAC Name | 5,5-dibromo-6-[[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]methoxy]-1,3-diazinane-2,4-dione |
| SMILES | COC1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](COC2NC(=O)NC(=O)C2(Br)Br)O1 |
| InChI | InChI=1S/C26H32Br2N2O6Si/c1-25(2,3)37(17-11-7-5-8-12-17,18-13-9-6-10-14-18)36-19-15-21(33-4)35-20(19)16-34-23-26(27,28)22(31)29-24(32)30-23/h5-14,19-21,23H,15-16H2,1-4H3,(H2,29,30,31,32)/t19-,20+,21?,23?/m0/s1 |
| InChIKey | ZQZOYZBRBKAILF-HUHVMKPBSA-N |
| XLogP | 3.36 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|