C20H30N2O7S — CID 51895319
[(1S,2S,3S,4R,5R)-3-hydroxy-2-(3-morpholin-4-ylpropylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate (PubChem CID 51895319) has the molecular formula C20H30N2O7S and a molecular weight of 442.53 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5R)-3-hydroxy-2-(3-morpholin-4-ylpropylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,3S,4R,5R)-3-hydroxy-2-(3-morpholin-4-ylpropylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 51895319 |
| Molecular Formula | C20H30N2O7S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [(1S,2S,3S,4R,5R)-3-hydroxy-2-(3-morpholin-4-ylpropylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H]3OC[C@@H](O3)[C@@H](NCCCN3CCOCC3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H30N2O7S/c1-14-3-5-15(6-4-14)30(24,25)29-19-18(23)17(16-13-27-20(19)28-16)21-7-2-8-22-9-11-26-12-10-22/h3-6,16-21,23H,2,7-13H2,1H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | KIPZUOHRYRCMSU-OUUBHVDSSA-N |
| XLogP | -0.13 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|