C19H29NO5S2 — CID 89394461
S-[2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropyl] 3-morpholin-4-ylpropanethioate (PubChem CID 89394461) has the molecular formula C19H29NO5S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is S-[2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropyl] 3-morpholin-4-ylpropanethioate.
| Compound Name | S-[2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropyl] 3-morpholin-4-ylpropanethioate |
|---|---|
| PubChem CID | 89394461 |
| Molecular Formula | C19H29NO5S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | S-[2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropyl] 3-morpholin-4-ylpropanethioate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)CSC(=O)CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C19H29NO5S2/c1-16-4-6-17(7-5-16)27(22,23)25-14-19(2,3)15-26-18(21)8-9-20-10-12-24-13-11-20/h4-7H,8-15H2,1-3H3 |
| InChIKey | OMIZZJINDHAURG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|