C12H24N2O2S — CID 126560086
S-(3-amino-2,2-dimethylpropyl) 3-morpholin-4-ylpropanethioate (PubChem CID 126560086) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is S-(3-amino-2,2-dimethylpropyl) 3-morpholin-4-ylpropanethioate.
| Compound Name | S-(3-amino-2,2-dimethylpropyl) 3-morpholin-4-ylpropanethioate |
|---|---|
| PubChem CID | 126560086 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | S-(3-amino-2,2-dimethylpropyl) 3-morpholin-4-ylpropanethioate |
| SMILES | CC(C)(CN)CSC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-12(2,9-13)10-17-11(15)3-4-14-5-7-16-8-6-14/h3-10,13H2,1-2H3 |
| InChIKey | FHXDXGVICQGOBF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|