C13H25NO2S — CID 123525707
S-(3,3-dimethylbutyl) 3-morpholin-4-ylpropanethioate (PubChem CID 123525707) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is S-(3,3-dimethylbutyl) 3-morpholin-4-ylpropanethioate.
| Compound Name | S-(3,3-dimethylbutyl) 3-morpholin-4-ylpropanethioate |
|---|---|
| PubChem CID | 123525707 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | S-(3,3-dimethylbutyl) 3-morpholin-4-ylpropanethioate |
| SMILES | CC(C)(C)CCSC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C13H25NO2S/c1-13(2,3)5-11-17-12(15)4-6-14-7-9-16-10-8-14/h4-11H2,1-3H3 |
| InChIKey | FMSMAHASDKANPP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|