C12H24N2O3 — CID 62974765
ethyl 2-amino-2-methyl-4-(1,4-oxazepan-4-yl)butanoate (PubChem CID 62974765) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is ethyl 2-amino-2-methyl-4-(1,4-oxazepan-4-yl)butanoate.
| Compound Name | ethyl 2-amino-2-methyl-4-(1,4-oxazepan-4-yl)butanoate |
|---|---|
| PubChem CID | 62974765 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethyl 2-amino-2-methyl-4-(1,4-oxazepan-4-yl)butanoate |
| SMILES | CCOC(=O)C(C)(N)CCN1CCCOCC1 |
| InChI | InChI=1S/C12H24N2O3/c1-3-17-11(15)12(2,13)5-7-14-6-4-9-16-10-8-14/h3-10,13H2,1-2H3 |
| InChIKey | KFZOIUYLVLYHTO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |