C13H24N2O3 — CID 63927435
ethyl 2-amino-2-cyclopropyl-3-(1,4-oxazepan-4-yl)propanoate (PubChem CID 63927435) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is ethyl 2-amino-2-cyclopropyl-3-(1,4-oxazepan-4-yl)propanoate.
| Compound Name | ethyl 2-amino-2-cyclopropyl-3-(1,4-oxazepan-4-yl)propanoate |
|---|---|
| PubChem CID | 63927435 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethyl 2-amino-2-cyclopropyl-3-(1,4-oxazepan-4-yl)propanoate |
| SMILES | CCOC(=O)C(N)(CN1CCCOCC1)C1CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-2-18-12(16)13(14,11-4-5-11)10-15-6-3-8-17-9-7-15/h11H,2-10,14H2,1H3 |
| InChIKey | GATIKPNZVNXABX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |