C13H24N2O3 — CID 63907673
ethyl 2-amino-2-cyclopropyl-3-(2-methylmorpholin-4-yl)propanoate (PubChem CID 63907673) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is ethyl 2-amino-2-cyclopropyl-3-(2-methylmorpholin-4-yl)propanoate.
| Compound Name | ethyl 2-amino-2-cyclopropyl-3-(2-methylmorpholin-4-yl)propanoate |
|---|---|
| PubChem CID | 63907673 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethyl 2-amino-2-cyclopropyl-3-(2-methylmorpholin-4-yl)propanoate |
| SMILES | CCOC(=O)C(N)(CN1CCOC(C)C1)C1CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-3-17-12(16)13(14,11-4-5-11)9-15-6-7-18-10(2)8-15/h10-11H,3-9,14H2,1-2H3 |
| InChIKey | ABQGZCUJDRCNLJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |