C15H29NO3 — CID 118259810
2,2-dimethylpropyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 118259810) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2,2-dimethylpropyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 118259810 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 2,2-dimethylpropyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | CC(C)(C)COC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C15H29NO3/c1-14(2,3)12-19-13(17)15(4,5)6-7-16-8-10-18-11-9-16/h6-12H2,1-5H3 |
| InChIKey | HOJRFPZLNZSWJH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |