C13H27N2O4PS — CID 145237039
2-(2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxyethylsulfanyl-N-methylphosphonamidous acid (PubChem CID 145237039) has the molecular formula C13H27N2O4PS and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxyethylsulfanyl-N-methylphosphonamidous acid.
| Compound Name | 2-(2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxyethylsulfanyl-N-methylphosphonamidous acid |
|---|---|
| PubChem CID | 145237039 |
| Molecular Formula | C13H27N2O4PS |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxyethylsulfanyl-N-methylphosphonamidous acid |
| SMILES | CNP(O)SCCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C13H27N2O4PS/c1-13(2,4-5-15-6-8-18-9-7-15)12(16)19-10-11-21-20(17)14-3/h14,17H,4-11H2,1-3H3 |
| InChIKey | BDOFWUIWMUXUSR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|