C17H35N2O5PSSe — CID 142489153
ethane;2-[nitroso(propan-2-yloxy)phosphinoselenoyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 142489153) has the molecular formula C17H35N2O5PSSe and a molecular weight of 489.48 g/mol. Its IUPAC name is ethane;2-[nitroso(propan-2-yloxy)phosphinoselenoyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | ethane;2-[nitroso(propan-2-yloxy)phosphinoselenoyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 142489153 |
| Molecular Formula | C17H35N2O5PSSe |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | ethane;2-[nitroso(propan-2-yloxy)phosphinoselenoyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | CC.CC(C)OP(=[Se])(N=O)SCCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C15H29N2O5PSSe.C2H6/c1-13(2)22-23(25,16-19)24-12-11-21-14(18)15(3,4)5-6-17-7-9-20-10-8-17;1-2/h13H,5-12H2,1-4H3;1-2H3 |
| InChIKey | SWAIBPLHKOFORV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|