C12H24NO6PS — CID 145397603
(2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxymethylsulfanyl-methoxyphosphinic acid (PubChem CID 145397603) has the molecular formula C12H24NO6PS and a molecular weight of 341.37 g/mol. Its IUPAC name is (2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxymethylsulfanyl-methoxyphosphinic acid.
| Compound Name | (2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxymethylsulfanyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 145397603 |
| Molecular Formula | C12H24NO6PS |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (2,2-dimethyl-4-morpholin-4-ylbutanoyl)oxymethylsulfanyl-methoxyphosphinic acid |
| SMILES | COP(=O)(O)SCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C12H24NO6PS/c1-12(2,4-5-13-6-8-18-9-7-13)11(14)19-10-21-20(15,16)17-3/h4-10H2,1-3H3,(H,15,16) |
| InChIKey | WFQVIXIPJOBSPT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|