C21H42NO6PS — CID 134232893
2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 134232893) has the molecular formula C21H42NO6PS and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 134232893 |
| Molecular Formula | C21H42NO6PS |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | CCCC(C)OP(=O)(OC(C)(C)C)SCCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C21H42NO6PS/c1-8-9-18(2)27-29(24,28-20(3,4)5)30-17-16-26-19(23)21(6,7)10-11-22-12-14-25-15-13-22/h18H,8-17H2,1-7H3 |
| InChIKey | KWSAQUUGUZYYFM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|