C21H43N2O5P — CID 135276580
2-[[2,2-dimethylpropyl-[(2-methylpropan-2-yl)oxy]phosphoryl]amino]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 135276580) has the molecular formula C21H43N2O5P and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[[2,2-dimethylpropyl-[(2-methylpropan-2-yl)oxy]phosphoryl]amino]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2-[[2,2-dimethylpropyl-[(2-methylpropan-2-yl)oxy]phosphoryl]amino]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 135276580 |
| Molecular Formula | C21H43N2O5P |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 2-[[2,2-dimethylpropyl-[(2-methylpropan-2-yl)oxy]phosphoryl]amino]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | CC(C)(C)CP(=O)(NCCOC(=O)C(C)(C)CCN1CCOCC1)OC(C)(C)C |
| InChI | InChI=1S/C21H43N2O5P/c1-19(2,3)17-29(25,28-20(4,5)6)22-10-14-27-18(24)21(7,8)9-11-23-12-15-26-16-13-23/h9-17H2,1-8H3,(H,22,25) |
| InChIKey | QRDBLTSETJJTDY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|