C21H42NO5PS2 — CID 134232921
2-[3-methylbutoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 134232921) has the molecular formula C21H42NO5PS2 and a molecular weight of 483.68 g/mol. Its IUPAC name is 2-[3-methylbutoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2-[3-methylbutoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 134232921 |
| Molecular Formula | C21H42NO5PS2 |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-[3-methylbutoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | CC(C)CCOP(=S)(OC(C)(C)C)SCCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C21H42NO5PS2/c1-18(2)8-13-26-28(29,27-20(3,4)5)30-17-16-25-19(23)21(6,7)9-10-22-11-14-24-15-12-22/h18H,8-17H2,1-7H3 |
| InChIKey | HSWRTBWARKUBGP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|