C13H27N2O3PS — CID 145237010
2-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoyl]oxyethylsulfanylphosphinous acid (PubChem CID 145237010) has the molecular formula C13H27N2O3PS and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoyl]oxyethylsulfanylphosphinous acid.
| Compound Name | 2-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoyl]oxyethylsulfanylphosphinous acid |
|---|---|
| PubChem CID | 145237010 |
| Molecular Formula | C13H27N2O3PS |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-[2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoyl]oxyethylsulfanylphosphinous acid |
| SMILES | CN1CCN(CCC(C)(C)C(=O)OCCSPO)CC1 |
| InChI | InChI=1S/C13H27N2O3PS/c1-13(2,12(16)18-10-11-20-19-17)4-5-15-8-6-14(3)7-9-15/h17,19H,4-11H2,1-3H3 |
| InChIKey | RTUVDSFXTWWJGL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|