C20H40N2O2S — CID 146618442
(5-ethylsulfanyl-3,3-dimethylpentyl) 2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoate (PubChem CID 146618442) has the molecular formula C20H40N2O2S and a molecular weight of 372.62 g/mol. Its IUPAC name is (5-ethylsulfanyl-3,3-dimethylpentyl) 2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoate.
| Compound Name | (5-ethylsulfanyl-3,3-dimethylpentyl) 2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoate |
|---|---|
| PubChem CID | 146618442 |
| Molecular Formula | C20H40N2O2S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | (5-ethylsulfanyl-3,3-dimethylpentyl) 2,2-dimethyl-4-(4-methylpiperazin-1-yl)butanoate |
| SMILES | CCSCCC(C)(C)CCOC(=O)C(C)(C)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C20H40N2O2S/c1-7-25-17-10-19(2,3)9-16-24-18(23)20(4,5)8-11-22-14-12-21(6)13-15-22/h7-17H2,1-6H3 |
| InChIKey | ZYZXOMDGSQSKLO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|