C12H24N3O3PS — CID 145293789
2-nitrosophosphanylsulfanylethyl 2,2-dimethyl-4-piperazin-1-ylbutanoate (PubChem CID 145293789) has the molecular formula C12H24N3O3PS and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-nitrosophosphanylsulfanylethyl 2,2-dimethyl-4-piperazin-1-ylbutanoate.
| Compound Name | 2-nitrosophosphanylsulfanylethyl 2,2-dimethyl-4-piperazin-1-ylbutanoate |
|---|---|
| PubChem CID | 145293789 |
| Molecular Formula | C12H24N3O3PS |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-nitrosophosphanylsulfanylethyl 2,2-dimethyl-4-piperazin-1-ylbutanoate |
| SMILES | CC(C)(CCN1CCNCC1)C(=O)OCCSPN=O |
| InChI | InChI=1S/C12H24N3O3PS/c1-12(2,3-6-15-7-4-13-5-8-15)11(16)18-9-10-20-19-14-17/h13,19H,3-10H2,1-2H3 |
| InChIKey | JHTKQRHVRBLDRI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|