C17H34NO5PS2 — CID 126560039
2-[(2-methylpropan-2-yl)oxy-methylsulfanylphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 126560039) has the molecular formula C17H34NO5PS2 and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy-methylsulfanylphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy-methylsulfanylphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 126560039 |
| Molecular Formula | C17H34NO5PS2 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy-methylsulfanylphosphoryl]sulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | CSP(=O)(OC(C)(C)C)SCCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C17H34NO5PS2/c1-16(2,3)23-24(20,25-6)26-14-13-22-15(19)17(4,5)7-8-18-9-11-21-12-10-18/h7-14H2,1-6H3 |
| InChIKey | SXTCMOFIUOKKBD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|