C24H48NO7P — CID 139303195
2-[bis(3-methylpentan-3-yloxy)phosphoryloxy]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 139303195) has the molecular formula C24H48NO7P and a molecular weight of 493.62 g/mol. Its IUPAC name is 2-[bis(3-methylpentan-3-yloxy)phosphoryloxy]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2-[bis(3-methylpentan-3-yloxy)phosphoryloxy]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 139303195 |
| Molecular Formula | C24H48NO7P |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 2-[bis(3-methylpentan-3-yloxy)phosphoryloxy]ethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | CCC(C)(CC)OP(=O)(OCCOC(=O)C(C)(C)CCN1CCOCC1)OC(C)(CC)CC |
| InChI | InChI=1S/C24H48NO7P/c1-9-23(7,10-2)31-33(27,32-24(8,11-3)12-4)30-20-19-29-21(26)22(5,6)13-14-25-15-17-28-18-16-25/h9-20H2,1-8H3 |
| InChIKey | SYLVSLODWZLWSP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|