C13H26NO7P — CID 134417479
2-[hydroxy(methoxy)phosphoryl]oxyethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 134417479) has the molecular formula C13H26NO7P and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-[hydroxy(methoxy)phosphoryl]oxyethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2-[hydroxy(methoxy)phosphoryl]oxyethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 134417479 |
| Molecular Formula | C13H26NO7P |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-[hydroxy(methoxy)phosphoryl]oxyethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | COP(=O)(O)OCCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C13H26NO7P/c1-13(2,4-5-14-6-8-19-9-7-14)12(15)20-10-11-21-22(16,17)18-3/h4-11H2,1-3H3,(H,16,17) |
| InChIKey | HLKRRGMWFUWOIG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|