C14H28NO5PS2 — CID 118262907
2-dimethoxyphosphinothioylsulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate (PubChem CID 118262907) has the molecular formula C14H28NO5PS2 and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-dimethoxyphosphinothioylsulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate.
| Compound Name | 2-dimethoxyphosphinothioylsulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 118262907 |
| Molecular Formula | C14H28NO5PS2 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-dimethoxyphosphinothioylsulfanylethyl 2,2-dimethyl-4-morpholin-4-ylbutanoate |
| SMILES | COP(=S)(OC)SCCOC(=O)C(C)(C)CCN1CCOCC1 |
| InChI | InChI=1S/C14H28NO5PS2/c1-14(2,5-6-15-7-9-19-10-8-15)13(16)20-11-12-23-21(22,17-3)18-4/h5-12H2,1-4H3 |
| InChIKey | VRCJOYUQBQIJBQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|