C17H31NO2S — CID 142320786
S-(3,3,6-trimethylhept-5-enyl) 3-morpholin-4-ylpropanethioate (PubChem CID 142320786) has the molecular formula C17H31NO2S and a molecular weight of 313.51 g/mol. Its IUPAC name is S-(3,3,6-trimethylhept-5-enyl) 3-morpholin-4-ylpropanethioate.
| Compound Name | S-(3,3,6-trimethylhept-5-enyl) 3-morpholin-4-ylpropanethioate |
|---|---|
| PubChem CID | 142320786 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | S-(3,3,6-trimethylhept-5-enyl) 3-morpholin-4-ylpropanethioate |
| SMILES | CC(C)=CCC(C)(C)CCSC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C17H31NO2S/c1-15(2)5-7-17(3,4)8-14-21-16(19)6-9-18-10-12-20-13-11-18/h5H,6-14H2,1-4H3 |
| InChIKey | IVDBVWZAQMSRAZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|