C20H31NO9S — CID 156867276
2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl morpholine-4-carboxylate (PubChem CID 156867276) has the molecular formula C20H31NO9S and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl morpholine-4-carboxylate.
| Compound Name | 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 156867276 |
| Molecular Formula | C20H31NO9S |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl morpholine-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H31NO9S/c1-18-2-4-19(5-3-18)31(23,24)30-17-15-28-13-11-26-10-12-27-14-16-29-20(22)21-6-8-25-9-7-21/h2-5H,6-17H2,1H3 |
| InChIKey | GLCOLDGULZLZTN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|