C17H26O6S — CID 162002712
oxan-4-ol;oxan-4-yl 4-methylbenzenesulfonate (PubChem CID 162002712) has the molecular formula C17H26O6S and a molecular weight of 358.46 g/mol. Its IUPAC name is oxan-4-ol;oxan-4-yl 4-methylbenzenesulfonate.
| Compound Name | oxan-4-ol;oxan-4-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162002712 |
| Molecular Formula | C17H26O6S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | oxan-4-ol;oxan-4-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCOCC2)cc1.OC1CCOCC1 |
| InChI | InChI=1S/C12H16O4S.C5H10O2/c1-10-2-4-12(5-3-10)17(13,14)16-11-6-8-15-9-7-11;6-5-1-3-7-4-2-5/h2-5,11H,6-9H2,1H3;5-6H,1-4H2 |
| InChIKey | YSKSCBAXVOAOJK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|