C13H16N4O4S — CID 45100745
N-[(1S,3R,4S,5R)-3-azido-6,8-dioxabicyclo[3.2.1]octan-4-yl]-4-methylbenzenesulfonamide (PubChem CID 45100745) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[(1S,3R,4S,5R)-3-azido-6,8-dioxabicyclo[3.2.1]octan-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,3R,4S,5R)-3-azido-6,8-dioxabicyclo[3.2.1]octan-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 45100745 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[(1S,3R,4S,5R)-3-azido-6,8-dioxabicyclo[3.2.1]octan-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2[C@@H]3OC[C@H](C[C@H]2N=[N+]=[N-])O3)cc1 |
| InChI | InChI=1S/C13H16N4O4S/c1-8-2-4-10(5-3-8)22(18,19)16-12-11(15-17-14)6-9-7-20-13(12)21-9/h2-5,9,11-13,16H,6-7H2,1H3/t9-,11+,12-,13+/m0/s1 |
| InChIKey | CEYCTWKOTDBYST-ZBAXXZLZSA-N |
| XLogP | 1.47 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|