C15H17NO4S — CID 11066768
(1S,2R,3R,4R)-3-[(4-methylphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 11066768) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-[(4-methylphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4R)-3-[(4-methylphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 11066768 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (1S,2R,3R,4R)-3-[(4-methylphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2[C@H](C(=O)O)[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C15H17NO4S/c1-9-2-6-12(7-3-9)21(19,20)16-14-11-5-4-10(8-11)13(14)15(17)18/h2-7,10-11,13-14,16H,8H2,1H3,(H,17,18)/t10-,11+,13-,14-/m1/s1 |
| InChIKey | WFALWFSFIUZNFX-ZMJPVWNMSA-N |
| XLogP | 1.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|